C11H11BrClN3O2 — CID 113337349
3-(3-bromo-4-chlorophenyl)-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine (PubChem CID 113337349) has the molecular formula C11H11BrClN3O2 and a molecular weight of 332.59 g/mol. Its IUPAC name is 3-(3-bromo-4-chlorophenyl)-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(3-bromo-4-chlorophenyl)-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 113337349 |
| Molecular Formula | C11H11BrClN3O2 |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 3-(3-bromo-4-chlorophenyl)-N-(2-methoxyethyl)-1,2,4-oxadiazol-5-amine |
| SMILES | COCCNc1nc(-c2ccc(Cl)c(Br)c2)no1 |
| InChI | InChI=1S/C11H11BrClN3O2/c1-17-5-4-14-11-15-10(16-18-11)7-2-3-9(13)8(12)6-7/h2-3,6H,4-5H2,1H3,(H,14,15,16) |
| InChIKey | AXBHYLQPVAMPFM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|