C13H16O4 — CID 11333817
(1R,5S,9R,13S)-9-hydroxy-3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-6,11-dien-8-one (PubChem CID 11333817) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (1R,5S,9R,13S)-9-hydroxy-3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-6,11-dien-8-one.
| Compound Name | (1R,5S,9R,13S)-9-hydroxy-3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-6,11-dien-8-one |
|---|---|
| PubChem CID | 11333817 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (1R,5S,9R,13S)-9-hydroxy-3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-6,11-dien-8-one |
| SMILES | CC1(C)O[C@H]2C=CC(=O)[C@@]3(O)CC=C[C@@H](O1)[C@@H]23 |
| InChI | InChI=1S/C13H16O4/c1-12(2)16-8-4-3-7-13(15)10(14)6-5-9(17-12)11(8)13/h3-6,8-9,11,15H,7H2,1-2H3/t8-,9+,11+,13+/m1/s1 |
| InChIKey | XVQFPLWPYHPGNU-KOVQTIFSSA-N |
| XLogP | 0.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|