C11H18N4O3 — CID 113338954
6-(2-but-3-enoxyethylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 113338954) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 6-(2-but-3-enoxyethylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(2-but-3-enoxyethylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 113338954 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 6-(2-but-3-enoxyethylamino)-2,4-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | C=CCCOCCNc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H18N4O3/c1-4-5-7-18-8-6-12-9-10(16)14(2)11(17)15(3)13-9/h4H,1,5-8H2,2-3H3,(H,12,13) |
| InChIKey | ZMYNGHXAGNKOSX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|