About 2-chloro-3-iodopyrazine
2-chloro-3-iodopyrazine (PubChem CID 11333928) has the molecular formula C4H2ClIN2
and a molecular weight of 240.43 g/mol. Its IUPAC name is 2-chloro-3-iodopyrazine.
Molecular Properties
| Compound Name | 2-chloro-3-iodopyrazine |
| PubChem CID | 11333928 |
| Molecular Formula | C4H2ClIN2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 239.90 |
| IUPAC Name | 2-chloro-3-iodopyrazine |
| SMILES | Clc1nccnc1I |
| InChI | InChI=1S/C4H2ClIN2/c5-3-4(6)8-2-1-7-3/h1-2H |
| InChIKey | ZEADRFPMIXXSLG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-iodopyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-iodopyrazine?
The IUPAC name of 2-chloro-3-iodopyrazine (CID 11333928) is 2-chloro-3-iodopyrazine.
What is the SMILES notation for 2-chloro-3-iodopyrazine?
The canonical SMILES for 2-chloro-3-iodopyrazine is Clc1nccnc1I.
What is the InChIKey of 2-chloro-3-iodopyrazine?
The InChIKey is ZEADRFPMIXXSLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClIN2/c5-3-4(6)8-2-1-7-3/h1-2H.
What are the key properties of 2-chloro-3-iodopyrazine?
2-chloro-3-iodopyrazine has a molecular weight of 240.43 g/mol, XLogP of 1.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-iodopyrazine is sourced from PubChem (CID 11333928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).