About quinolin-7-yl N,N-diethylcarbamate
quinolin-7-yl N,N-diethylcarbamate (PubChem CID 11334036) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is quinolin-7-yl N,N-diethylcarbamate.
Molecular Properties
| Compound Name | quinolin-7-yl N,N-diethylcarbamate |
| PubChem CID | 11334036 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | quinolin-7-yl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc2cccnc2c1 |
| InChI | InChI=1S/C14H16N2O2/c1-3-16(4-2)14(17)18-12-8-7-11-6-5-9-15-13(11)10-12/h5-10H,3-4H2,1-2H3 |
| InChIKey | UBMMLTWYBARHRK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinolin-7-yl N,N-diethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-7-yl N,N-diethylcarbamate?
The IUPAC name of quinolin-7-yl N,N-diethylcarbamate (CID 11334036) is quinolin-7-yl N,N-diethylcarbamate.
What is the SMILES notation for quinolin-7-yl N,N-diethylcarbamate?
The canonical SMILES for quinolin-7-yl N,N-diethylcarbamate is CCN(CC)C(=O)Oc1ccc2cccnc2c1.
What is the InChIKey of quinolin-7-yl N,N-diethylcarbamate?
The InChIKey is UBMMLTWYBARHRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-3-16(4-2)14(17)18-12-8-7-11-6-5-9-15-13(11)10-12/h5-10H,3-4H2,1-2H3.
What are the key properties of quinolin-7-yl N,N-diethylcarbamate?
quinolin-7-yl N,N-diethylcarbamate has a molecular weight of 244.29 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-7-yl N,N-diethylcarbamate is sourced from PubChem (CID 11334036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).