C15H22O3 — CID 11334198
(1S,3aR,9aS,9bS)-1-methoxy-9a,9b-dimethyl-3,3a,4,5,8,9-hexahydro-1H-benzo[e][2]benzofuran-7-one (PubChem CID 11334198) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1S,3aR,9aS,9bS)-1-methoxy-9a,9b-dimethyl-3,3a,4,5,8,9-hexahydro-1H-benzo[e][2]benzofuran-7-one.
| Compound Name | (1S,3aR,9aS,9bS)-1-methoxy-9a,9b-dimethyl-3,3a,4,5,8,9-hexahydro-1H-benzo[e][2]benzofuran-7-one |
|---|---|
| PubChem CID | 11334198 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1S,3aR,9aS,9bS)-1-methoxy-9a,9b-dimethyl-3,3a,4,5,8,9-hexahydro-1H-benzo[e][2]benzofuran-7-one |
| SMILES | CO[C@H]1OC[C@@H]2CCC3=CC(=O)CC[C@]3(C)[C@]21C |
| InChI | InChI=1S/C15H22O3/c1-14-7-6-12(16)8-10(14)4-5-11-9-18-13(17-3)15(11,14)2/h8,11,13H,4-7,9H2,1-3H3/t11-,13-,14-,15+/m0/s1 |
| InChIKey | PLAGUGCMGGMEPS-CYUUQNCZSA-N |
| XLogP | 2.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |