C12H9F3N2O — CID 11334268
2,2,2-trifluoro-1,1-dipyridin-2-ylethanol (PubChem CID 11334268) has the molecular formula C12H9F3N2O and a molecular weight of 254.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-1,1-dipyridin-2-ylethanol.
| Compound Name | 2,2,2-trifluoro-1,1-dipyridin-2-ylethanol |
|---|---|
| PubChem CID | 11334268 |
| Molecular Formula | C12H9F3N2O |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2,2,2-trifluoro-1,1-dipyridin-2-ylethanol |
| SMILES | OC(c1ccccn1)(c1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C12H9F3N2O/c13-12(14,15)11(18,9-5-1-3-7-16-9)10-6-2-4-8-17-10/h1-8,18H |
| InChIKey | PKCQPUXHNMHHSA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |