About 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride
6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride (PubChem CID 11334359) has the molecular formula C12H14ClFN2O
and a molecular weight of 256.71 g/mol. Its IUPAC name is 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride.
Molecular Properties
| Compound Name | 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride |
| PubChem CID | 11334359 |
| Molecular Formula | C12H14ClFN2O |
| Molecular Weight | 256.71 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride |
| SMILES | Cl.Fc1ccc2c(C3CCNCC3)noc2c1 |
| InChI | InChI=1S/C12H13FN2O.ClH/c13-9-1-2-10-11(7-9)16-15-12(10)8-3-5-14-6-4-8;/h1-2,7-8,14H,3-6H2;1H |
| InChIKey | CWPSRUREOSBKBQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.71 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride?
The IUPAC name of 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride (CID 11334359) is 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride.
What is the SMILES notation for 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride?
The canonical SMILES for 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride is Cl.Fc1ccc2c(C3CCNCC3)noc2c1.
What is the InChIKey of 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride?
The InChIKey is CWPSRUREOSBKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2O.ClH/c13-9-1-2-10-11(7-9)16-15-12(10)8-3-5-14-6-4-8;/h1-2,7-8,14H,3-6H2;1H.
What are the key properties of 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride?
6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride has a molecular weight of 256.71 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-piperidin-4-yl-1,2-benzoxazole;hydrochloride is sourced from PubChem (CID 11334359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).