C14H24N2O2 — CID 113344548
2-[[4-(dimethylamino)phenyl]methylamino]-2-ethylpropane-1,3-diol (PubChem CID 113344548) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)phenyl]methylamino]-2-ethylpropane-1,3-diol.
| Compound Name | 2-[[4-(dimethylamino)phenyl]methylamino]-2-ethylpropane-1,3-diol |
|---|---|
| PubChem CID | 113344548 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-[[4-(dimethylamino)phenyl]methylamino]-2-ethylpropane-1,3-diol |
| SMILES | CCC(CO)(CO)NCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H24N2O2/c1-4-14(10-17,11-18)15-9-12-5-7-13(8-6-12)16(2)3/h5-8,15,17-18H,4,9-11H2,1-3H3 |
| InChIKey | XHVWFWKTYIFSHL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|