C13H11BrIN3O — CID 113344575
N-(3-bromo-4-iodophenyl)-3,6-dimethylpyridazine-4-carboxamide (PubChem CID 113344575) has the molecular formula C13H11BrIN3O and a molecular weight of 432.06 g/mol. Its IUPAC name is N-(3-bromo-4-iodophenyl)-3,6-dimethylpyridazine-4-carboxamide.
| Compound Name | N-(3-bromo-4-iodophenyl)-3,6-dimethylpyridazine-4-carboxamide |
|---|---|
| PubChem CID | 113344575 |
| Molecular Formula | C13H11BrIN3O |
| Molecular Weight | 432.06 g/mol |
| Exact Mass | 430.91 |
| IUPAC Name | N-(3-bromo-4-iodophenyl)-3,6-dimethylpyridazine-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(I)c(Br)c2)c(C)nn1 |
| InChI | InChI=1S/C13H11BrIN3O/c1-7-5-10(8(2)18-17-7)13(19)16-9-3-4-12(15)11(14)6-9/h3-6H,1-2H3,(H,16,19) |
| InChIKey | WXMLMUAELPKZTQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.06 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|