C15H18O4 — CID 11334506
(2R,7R)-8,8-dimethyl-3,9,13,15-tetraoxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16)-triene (PubChem CID 11334506) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (2R,7R)-8,8-dimethyl-3,9,13,15-tetraoxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16)-triene.
| Compound Name | (2R,7R)-8,8-dimethyl-3,9,13,15-tetraoxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16)-triene |
|---|---|
| PubChem CID | 11334506 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (2R,7R)-8,8-dimethyl-3,9,13,15-tetraoxatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),10,12(16)-triene |
| SMILES | CC1(C)Oc2cc3c(cc2[C@@H]2OCCC[C@H]21)OCO3 |
| InChI | InChI=1S/C15H18O4/c1-15(2)10-4-3-5-16-14(10)9-6-12-13(18-8-17-12)7-11(9)19-15/h6-7,10,14H,3-5,8H2,1-2H3/t10-,14+/m1/s1 |
| InChIKey | NWNJBNDMHZLJSC-YGRLFVJLSA-N |
| XLogP | 3.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |