C14H18Br2N2O — CID 113345204
(2,4-dibromophenyl)-[4-(dimethylamino)piperidin-1-yl]methanone (PubChem CID 113345204) has the molecular formula C14H18Br2N2O and a molecular weight of 390.12 g/mol. Its IUPAC name is (2,4-dibromophenyl)-[4-(dimethylamino)piperidin-1-yl]methanone.
| Compound Name | (2,4-dibromophenyl)-[4-(dimethylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 113345204 |
| Molecular Formula | C14H18Br2N2O |
| Molecular Weight | 390.12 g/mol |
| Exact Mass | 387.98 |
| IUPAC Name | (2,4-dibromophenyl)-[4-(dimethylamino)piperidin-1-yl]methanone |
| SMILES | CN(C)C1CCN(C(=O)c2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C14H18Br2N2O/c1-17(2)11-5-7-18(8-6-11)14(19)12-4-3-10(15)9-13(12)16/h3-4,9,11H,5-8H2,1-2H3 |
| InChIKey | KUHPFKYYRGYVHE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.12 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |