C15H21NO2 — CID 113345738
N-(3,3-dimethylcyclopentyl)-2-(2-hydroxyphenyl)acetamide (PubChem CID 113345738) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-2-(2-hydroxyphenyl)acetamide.
| Compound Name | N-(3,3-dimethylcyclopentyl)-2-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 113345738 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-2-(2-hydroxyphenyl)acetamide |
| SMILES | CC1(C)CCC(NC(=O)Cc2ccccc2O)C1 |
| InChI | InChI=1S/C15H21NO2/c1-15(2)8-7-12(10-15)16-14(18)9-11-5-3-4-6-13(11)17/h3-6,12,17H,7-10H2,1-2H3,(H,16,18) |
| InChIKey | ROSTYWQVLGGRHW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |