About 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate
4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate (PubChem CID 11334645) has the molecular formula C14H21NO4
and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate.
Molecular Properties
| Compound Name | 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate |
| PubChem CID | 11334645 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate |
| SMILES | C=CCOC(=O)N1CC=C(C(=O)OC)C[C@H]1C(C)C |
| InChI | InChI=1S/C14H21NO4/c1-5-8-19-14(17)15-7-6-11(13(16)18-4)9-12(15)10(2)3/h5-6,10,12H,1,7-9H2,2-4H3/t12-/m0/s1 |
| InChIKey | MEEJQZYGQFCSRU-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate?
The IUPAC name of 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate (CID 11334645) is 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate.
What is the SMILES notation for 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate?
The canonical SMILES for 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate is C=CCOC(=O)N1CC=C(C(=O)OC)C[C@H]1C(C)C.
What is the InChIKey of 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate?
The InChIKey is MEEJQZYGQFCSRU-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H21NO4/c1-5-8-19-14(17)15-7-6-11(13(16)18-4)9-12(15)10(2)3/h5-6,10,12H,1,7-9H2,2-4H3/t12-/m0/s1.
What are the key properties of 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate?
4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate has a molecular weight of 267.32 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-methyl 1-O-prop-2-enyl (2S)-2-propan-2-yl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate is sourced from PubChem (CID 11334645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).