C12H11N5O — CID 113347556
2-[([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)methyl]phenol (PubChem CID 113347556) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)methyl]phenol.
| Compound Name | 2-[([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 113347556 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-[([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)methyl]phenol |
| SMILES | Oc1ccccc1CNc1nccn2cnnc12 |
| InChI | InChI=1S/C12H11N5O/c18-10-4-2-1-3-9(10)7-14-11-12-16-15-8-17(12)6-5-13-11/h1-6,8,18H,7H2,(H,13,14) |
| InChIKey | KETVMIPZESSKMW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|