About trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane
trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane (PubChem CID 11334758) has the molecular formula C10H17Cl3Si
and a molecular weight of 271.69 g/mol. Its IUPAC name is trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane.
Molecular Properties
| Compound Name | trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane |
| PubChem CID | 11334758 |
| Molecular Formula | C10H17Cl3Si |
| Molecular Weight | 271.69 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane |
| SMILES | CC(C)=CCC/C(C)=C/C[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C10H17Cl3Si/c1-9(2)5-4-6-10(3)7-8-14(11,12)13/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | GKYNOXGCIYHMEZ-JXMROGBWSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane?
The IUPAC name of trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane (CID 11334758) is trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane.
What is the SMILES notation for trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane?
The canonical SMILES for trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane is CC(C)=CCC/C(C)=C/C[Si](Cl)(Cl)Cl.
What is the InChIKey of trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane?
The InChIKey is GKYNOXGCIYHMEZ-JXMROGBWSA-N. The full InChI is InChI=1S/C10H17Cl3Si/c1-9(2)5-4-6-10(3)7-8-14(11,12)13/h5,7H,4,6,8H2,1-3H3/b10-7+.
What are the key properties of trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane?
trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane has a molecular weight of 271.69 g/mol, XLogP of 5.33, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro-[(2E)-3,7-dimethylocta-2,6-dienyl]silane is sourced from PubChem (CID 11334758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).