C13H18ClNO2 — CID 113347731
4-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzamide (PubChem CID 113347731) has the molecular formula C13H18ClNO2 and a molecular weight of 255.75 g/mol. Its IUPAC name is 4-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzamide.
| Compound Name | 4-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 113347731 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)benzamide |
| SMILES | CC(C)(O)C(C)(C)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO2/c1-12(2,13(3,4)17)15-11(16)9-5-7-10(14)8-6-9/h5-8,17H,1-4H3,(H,15,16) |
| InChIKey | XHNLDKVLFJVFCU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |