C15H20N2O — CID 113348897
5-(hex-5-ynylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one (PubChem CID 113348897) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 5-(hex-5-ynylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one.
| Compound Name | 5-(hex-5-ynylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 113348897 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 5-(hex-5-ynylamino)-5,6,7,8-tetrahydro-1H-quinolin-2-one |
| SMILES | C#CCCCCNC1CCCc2[nH]c(=O)ccc21 |
| InChI | InChI=1S/C15H20N2O/c1-2-3-4-5-11-16-13-7-6-8-14-12(13)9-10-15(18)17-14/h1,9-10,13,16H,3-8,11H2,(H,17,18) |
| InChIKey | KHPVPKNKZYHOOP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|