C14H21NOS2 — CID 113348939
(6S)-6-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine (PubChem CID 113348939) has the molecular formula C14H21NOS2 and a molecular weight of 283.46 g/mol. Its IUPAC name is (6S)-6-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine.
| Compound Name | (6S)-6-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
|---|---|
| PubChem CID | 113348939 |
| Molecular Formula | C14H21NOS2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (6S)-6-methyl-N-[2-(2-methylprop-2-enoxy)ethyl]-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
| SMILES | C=C(C)COCCNC1C[C@H](C)Sc2sccc21 |
| InChI | InChI=1S/C14H21NOS2/c1-10(2)9-16-6-5-15-13-8-11(3)18-14-12(13)4-7-17-14/h4,7,11,13,15H,1,5-6,8-9H2,2-3H3/t11-,13?/m0/s1 |
| InChIKey | DBKOFFAVOWKDNC-AMGKYWFPSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|