About 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole
3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole (PubChem CID 11335037) has the molecular formula C16H14N2O3
and a molecular weight of 282.30 g/mol. Its IUPAC name is 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole.
Molecular Properties
| Compound Name | 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole |
| PubChem CID | 11335037 |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole |
| SMILES | COc1ccc(-c2nonc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C16H14N2O3/c1-19-13-7-3-11(4-8-13)15-16(18-21-17-15)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3 |
| InChIKey | GLGBZVUSHBPCMJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole?
The IUPAC name of 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole (CID 11335037) is 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole.
What is the SMILES notation for 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole?
The canonical SMILES for 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole is COc1ccc(-c2nonc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole?
The InChIKey is GLGBZVUSHBPCMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3/c1-19-13-7-3-11(4-8-13)15-16(18-21-17-15)12-5-9-14(20-2)10-6-12/h3-10H,1-2H3.
What are the key properties of 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole?
3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole has a molecular weight of 282.30 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(4-methoxyphenyl)-1,2,5-oxadiazole is sourced from PubChem (CID 11335037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).