About N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine
N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine (PubChem CID 113350821) has the molecular formula C12H20N2O2S2
and a molecular weight of 288.44 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine.
Molecular Properties
| Compound Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine |
| PubChem CID | 113350821 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine |
| SMILES | CCc1cnc(CNC2CCCC2S(C)(=O)=O)s1 |
| InChI | InChI=1S/C12H20N2O2S2/c1-3-9-7-14-12(17-9)8-13-10-5-4-6-11(10)18(2,15)16/h7,10-11,13H,3-6,8H2,1-2H3 |
| InChIKey | OJWQJTWVXRZTNE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine?
The IUPAC name of N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine (CID 113350821) is N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine.
What is the SMILES notation for N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine?
The canonical SMILES for N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine is CCc1cnc(CNC2CCCC2S(C)(=O)=O)s1.
What is the InChIKey of N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine?
The InChIKey is OJWQJTWVXRZTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2S2/c1-3-9-7-14-12(17-9)8-13-10-5-4-6-11(10)18(2,15)16/h7,10-11,13H,3-6,8H2,1-2H3.
What are the key properties of N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine?
N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine has a molecular weight of 288.44 g/mol, XLogP of 1.76, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-methylsulfonylcyclopentan-1-amine is sourced from PubChem (CID 113350821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).