C12H20N2O3S — CID 113351813
N-(6-hydroxyhexyl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide (PubChem CID 113351813) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide.
| Compound Name | N-(6-hydroxyhexyl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
|---|---|
| PubChem CID | 113351813 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-(6-hydroxyhexyl)-2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetamide |
| SMILES | Cc1csc(=O)n1CC(=O)NCCCCCCO |
| InChI | InChI=1S/C12H20N2O3S/c1-10-9-18-12(17)14(10)8-11(16)13-6-4-2-3-5-7-15/h9,15H,2-8H2,1H3,(H,13,16) |
| InChIKey | WNSQPHNGPNXMQI-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|