About 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol
3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol (PubChem CID 113352181) has the molecular formula C12H21F2NO2
and a molecular weight of 249.30 g/mol. Its IUPAC name is 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol |
| PubChem CID | 113352181 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol |
| SMILES | CC1(C)C(NCC(O)C(F)F)C2CCCOC21 |
| InChI | InChI=1S/C12H21F2NO2/c1-12(2)9(15-6-8(16)11(13)14)7-4-3-5-17-10(7)12/h7-11,15-16H,3-6H2,1-2H3 |
| InChIKey | PAVIMKOVIXTPHL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol?
The IUPAC name of 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol (CID 113352181) is 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol.
What is the SMILES notation for 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol?
The canonical SMILES for 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol is CC1(C)C(NCC(O)C(F)F)C2CCCOC21.
What is the InChIKey of 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol?
The InChIKey is PAVIMKOVIXTPHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO2/c1-12(2)9(15-6-8(16)11(13)14)7-4-3-5-17-10(7)12/h7-11,15-16H,3-6H2,1-2H3.
What are the key properties of 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol?
3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol has a molecular weight of 249.30 g/mol, XLogP of 1.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]-1,1-difluoropropan-2-ol is sourced from PubChem (CID 113352181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).