C18H34N2O4 — CID 113352339
ethyl 4-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]cyclohexane-1-carboxylate (PubChem CID 113352339) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is ethyl 4-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 113352339 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | ethyl 4-[3-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propylamino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(NCCCN(C)C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H34N2O4/c1-6-23-16(21)14-8-10-15(11-9-14)19-12-7-13-20(5)17(22)24-18(2,3)4/h14-15,19H,6-13H2,1-5H3 |
| InChIKey | ICELJFQIRSRGAB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|