C14H21ClN2O — CID 113353557
2-amino-N-[(1S)-1-(3-chlorophenyl)ethyl]-3,3-dimethylbutanamide (PubChem CID 113353557) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-amino-N-[(1S)-1-(3-chlorophenyl)ethyl]-3,3-dimethylbutanamide.
| Compound Name | 2-amino-N-[(1S)-1-(3-chlorophenyl)ethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 113353557 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-amino-N-[(1S)-1-(3-chlorophenyl)ethyl]-3,3-dimethylbutanamide |
| SMILES | C[C@H](NC(=O)C(N)C(C)(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2O/c1-9(10-6-5-7-11(15)8-10)17-13(18)12(16)14(2,3)4/h5-9,12H,16H2,1-4H3,(H,17,18)/t9-,12?/m0/s1 |
| InChIKey | QFZRDANUIKQTQO-QHGLUPRGSA-N |
| XLogP | 2.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |