C12H19N3O2 — CID 113353757
1-cyclopropyl-3-(2-ethoxypropylamino)pyrazin-2-one (PubChem CID 113353757) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-cyclopropyl-3-(2-ethoxypropylamino)pyrazin-2-one.
| Compound Name | 1-cyclopropyl-3-(2-ethoxypropylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 113353757 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-cyclopropyl-3-(2-ethoxypropylamino)pyrazin-2-one |
| SMILES | CCOC(C)CNc1nccn(C2CC2)c1=O |
| InChI | InChI=1S/C12H19N3O2/c1-3-17-9(2)8-14-11-12(16)15(7-6-13-11)10-4-5-10/h6-7,9-10H,3-5,8H2,1-2H3,(H,13,14) |
| InChIKey | WCKHQFXYHVJMOS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |