C15H28N2O — CID 113353990
N-(3,3,5,5-tetramethylcyclohexyl)pyrrolidine-1-carboxamide (PubChem CID 113353990) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is N-(3,3,5,5-tetramethylcyclohexyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3,3,5,5-tetramethylcyclohexyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 113353990 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | N-(3,3,5,5-tetramethylcyclohexyl)pyrrolidine-1-carboxamide |
| SMILES | CC1(C)CC(NC(=O)N2CCCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H28N2O/c1-14(2)9-12(10-15(3,4)11-14)16-13(18)17-7-5-6-8-17/h12H,5-11H2,1-4H3,(H,16,18) |
| InChIKey | XUNXKEREMZUPIT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |