About N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine
N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine (PubChem CID 113354642) has the molecular formula C22H35NO2
and a molecular weight of 345.53 g/mol. Its IUPAC name is N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine.
Molecular Properties
| Compound Name | N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine |
| PubChem CID | 113354642 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine |
| SMILES | CC(C)(CNCc1ccccc1)COC1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C22H35NO2/c1-21(2,17-23-16-19-9-5-3-6-10-19)18-24-20-11-14-25-22(15-20)12-7-4-8-13-22/h3,5-6,9-10,20,23H,4,7-8,11-18H2,1-2H3 |
| InChIKey | FMYJLGUVTXXUPX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine?
The IUPAC name of N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine (CID 113354642) is N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine.
What is the SMILES notation for N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine?
The canonical SMILES for N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine is CC(C)(CNCc1ccccc1)COC1CCOC2(CCCCC2)C1.
What is the InChIKey of N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine?
The InChIKey is FMYJLGUVTXXUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35NO2/c1-21(2,17-23-16-19-9-5-3-6-10-19)18-24-20-11-14-25-22(15-20)12-7-4-8-13-22/h3,5-6,9-10,20,23H,4,7-8,11-18H2,1-2H3.
What are the key properties of N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine?
N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine has a molecular weight of 345.53 g/mol, XLogP of 4.70, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,2-dimethyl-3-(1-oxaspiro[5.5]undecan-4-yloxy)propan-1-amine is sourced from PubChem (CID 113354642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).