C14H19NO3S — CID 113354769
3-(1,1-dioxo-1,4-thiazepan-4-yl)-1-phenylpropan-1-one (PubChem CID 113354769) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,4-thiazepan-4-yl)-1-phenylpropan-1-one.
| Compound Name | 3-(1,1-dioxo-1,4-thiazepan-4-yl)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 113354769 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-(1,1-dioxo-1,4-thiazepan-4-yl)-1-phenylpropan-1-one |
| SMILES | O=C(CCN1CCCS(=O)(=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C14H19NO3S/c16-14(13-5-2-1-3-6-13)7-9-15-8-4-11-19(17,18)12-10-15/h1-3,5-6H,4,7-12H2 |
| InChIKey | FHWSLXSMDYUSSO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |