About [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate
[(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate (PubChem CID 11335572) has the molecular formula C11H15F3O4S
and a molecular weight of 300.30 g/mol. Its IUPAC name is [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate |
| PubChem CID | 11335572 |
| Molecular Formula | C11H15F3O4S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(COS(=O)(=O)C(F)(F)F)C(=O)C2 |
| InChI | InChI=1S/C11H15F3O4S/c1-9(2)7-3-4-10(9,8(15)5-7)6-18-19(16,17)11(12,13)14/h7H,3-6H2,1-2H3/t7-,10-/m1/s1 |
| InChIKey | WJKOSOJTHPQANX-GMSGAONNSA-N |
| XLogP | 2.25 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate?
The IUPAC name of [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate (CID 11335572) is [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate.
What is the SMILES notation for [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate?
The canonical SMILES for [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate is CC1(C)[C@@H]2CC[C@@]1(COS(=O)(=O)C(F)(F)F)C(=O)C2.
What is the InChIKey of [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate?
The InChIKey is WJKOSOJTHPQANX-GMSGAONNSA-N. The full InChI is InChI=1S/C11H15F3O4S/c1-9(2)7-3-4-10(9,8(15)5-7)6-18-19(16,17)11(12,13)14/h7H,3-6H2,1-2H3/t7-,10-/m1/s1.
What are the key properties of [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate?
[(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate has a molecular weight of 300.30 g/mol, XLogP of 2.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methyl trifluoromethanesulfonate is sourced from PubChem (CID 11335572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).