C12H9BrN4S — CID 113355941
N-[(5-bromoquinolin-8-yl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 113355941) has the molecular formula C12H9BrN4S and a molecular weight of 321.20 g/mol. Its IUPAC name is N-[(5-bromoquinolin-8-yl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[(5-bromoquinolin-8-yl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 113355941 |
| Molecular Formula | C12H9BrN4S |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | N-[(5-bromoquinolin-8-yl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Brc1ccc(CNc2nncs2)c2ncccc12 |
| InChI | InChI=1S/C12H9BrN4S/c13-10-4-3-8(6-15-12-17-16-7-18-12)11-9(10)2-1-5-14-11/h1-5,7H,6H2,(H,15,17) |
| InChIKey | WNAXOTLCESVJBG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |