C11H14N2O4 — CID 113358708
methyl 2-hydroxy-3-[(3-methylpyridine-2-carbonyl)amino]propanoate (PubChem CID 113358708) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(3-methylpyridine-2-carbonyl)amino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[(3-methylpyridine-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 113358708 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | methyl 2-hydroxy-3-[(3-methylpyridine-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(O)CNC(=O)c1ncccc1C |
| InChI | InChI=1S/C11H14N2O4/c1-7-4-3-5-12-9(7)10(15)13-6-8(14)11(16)17-2/h3-5,8,14H,6H2,1-2H3,(H,13,15) |
| InChIKey | PVLOHNULMRQYOD-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |