C15H28N2 — CID 113359705
1-(3,3,5,5-tetramethylcyclohexyl)piperidin-2-imine (PubChem CID 113359705) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 1-(3,3,5,5-tetramethylcyclohexyl)piperidin-2-imine.
| Compound Name | 1-(3,3,5,5-tetramethylcyclohexyl)piperidin-2-imine |
|---|---|
| PubChem CID | 113359705 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 1-(3,3,5,5-tetramethylcyclohexyl)piperidin-2-imine |
| SMILES | [H]/N=C1\CCCCN1C1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H28N2/c1-14(2)9-12(10-15(3,4)11-14)17-8-6-5-7-13(17)16/h12,16H,5-11H2,1-4H3/b16-13+ |
| InChIKey | KRMVPRDZHMBYGT-DTQAZKPQSA-N |
| XLogP | 4.05 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|