C15H20Cl3N — CID 113359870
N-[[1-(chloromethyl)cyclohexyl]methyl]-1-(2,6-dichlorophenyl)methanamine (PubChem CID 113359870) has the molecular formula C15H20Cl3N and a molecular weight of 320.69 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclohexyl]methyl]-1-(2,6-dichlorophenyl)methanamine.
| Compound Name | N-[[1-(chloromethyl)cyclohexyl]methyl]-1-(2,6-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 113359870 |
| Molecular Formula | C15H20Cl3N |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[[1-(chloromethyl)cyclohexyl]methyl]-1-(2,6-dichlorophenyl)methanamine |
| SMILES | ClCC1(CNCc2c(Cl)cccc2Cl)CCCCC1 |
| InChI | InChI=1S/C15H20Cl3N/c16-10-15(7-2-1-3-8-15)11-19-9-12-13(17)5-4-6-14(12)18/h4-6,19H,1-3,7-11H2 |
| InChIKey | AEHNZBANSBOIKC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|