C14H11F3N2O — CID 11336079
(10bR)-9-ethynyl-7-(trifluoromethyl)-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one (PubChem CID 11336079) has the molecular formula C14H11F3N2O and a molecular weight of 280.25 g/mol. Its IUPAC name is (10bR)-9-ethynyl-7-(trifluoromethyl)-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one.
| Compound Name | (10bR)-9-ethynyl-7-(trifluoromethyl)-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one |
|---|---|
| PubChem CID | 11336079 |
| Molecular Formula | C14H11F3N2O |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (10bR)-9-ethynyl-7-(trifluoromethyl)-2,3,4,10b-tetrahydro-1H-pyrazino[1,2-b]isoindol-6-one |
| SMILES | C#Cc1cc2c(c(C(F)(F)F)c1)C(=O)N1CCNC[C@@H]21 |
| InChI | InChI=1S/C14H11F3N2O/c1-2-8-5-9-11-7-18-3-4-19(11)13(20)12(9)10(6-8)14(15,16)17/h1,5-6,11,18H,3-4,7H2/t11-/m0/s1 |
| InChIKey | NJEJBZZKHLSYTJ-NSHDSACASA-N |
| XLogP | 1.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|