C20H30O3 — CID 11336135
(1R,2S,4aS,7S,10aR)-7-ethenyl-2-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-2,3,4,5,6,8,10,10a-octahydrophenanthren-9-one (PubChem CID 11336135) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,2S,4aS,7S,10aR)-7-ethenyl-2-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-2,3,4,5,6,8,10,10a-octahydrophenanthren-9-one.
| Compound Name | (1R,2S,4aS,7S,10aR)-7-ethenyl-2-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-2,3,4,5,6,8,10,10a-octahydrophenanthren-9-one |
|---|---|
| PubChem CID | 11336135 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,2S,4aS,7S,10aR)-7-ethenyl-2-hydroxy-1-(hydroxymethyl)-1,4a,7-trimethyl-2,3,4,5,6,8,10,10a-octahydrophenanthren-9-one |
| SMILES | C=C[C@@]1(C)CCC2=C(C1)C(=O)C[C@H]1[C@](C)(CO)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C20H30O3/c1-5-18(2)8-6-14-13(11-18)15(22)10-16-19(14,3)9-7-17(23)20(16,4)12-21/h5,16-17,21,23H,1,6-12H2,2-4H3/t16-,17+,18+,19-,20+/m1/s1 |
| InChIKey | QMKTXDWPIMLEBB-CXQPBAHBSA-N |
| XLogP | 3.41 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|