C16H19NO4S — CID 11336215
ethyl (1S,3S,4R)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate (PubChem CID 11336215) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is ethyl (1S,3S,4R)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate.
| Compound Name | ethyl (1S,3S,4R)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
|---|---|
| PubChem CID | 11336215 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | ethyl (1S,3S,4R)-2-(4-methylphenyl)sulfonyl-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C=C[C@H](C2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H19NO4S/c1-3-21-16(18)15-12-6-7-13(10-12)17(15)22(19,20)14-8-4-11(2)5-9-14/h4-9,12-13,15H,3,10H2,1-2H3/t12-,13+,15-/m0/s1 |
| InChIKey | PQQJISXTXJAUJL-GUTXKFCHSA-N |
| XLogP | 1.88 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|