C12H18IN3O — CID 113362270
5-iodo-2-(oxolan-3-ylmethyl)-N-propylpyrimidin-4-amine (PubChem CID 113362270) has the molecular formula C12H18IN3O and a molecular weight of 347.20 g/mol. Its IUPAC name is 5-iodo-2-(oxolan-3-ylmethyl)-N-propylpyrimidin-4-amine.
| Compound Name | 5-iodo-2-(oxolan-3-ylmethyl)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 113362270 |
| Molecular Formula | C12H18IN3O |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 5-iodo-2-(oxolan-3-ylmethyl)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(CC2CCOC2)ncc1I |
| InChI | InChI=1S/C12H18IN3O/c1-2-4-14-12-10(13)7-15-11(16-12)6-9-3-5-17-8-9/h7,9H,2-6,8H2,1H3,(H,14,15,16) |
| InChIKey | RICFQLFTMMNFMZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|