C13H17N3O — CID 113362602
3-[2-(oxan-2-yl)ethylamino]pyridine-4-carbonitrile (PubChem CID 113362602) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-[2-(oxan-2-yl)ethylamino]pyridine-4-carbonitrile.
| Compound Name | 3-[2-(oxan-2-yl)ethylamino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 113362602 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-[2-(oxan-2-yl)ethylamino]pyridine-4-carbonitrile |
| SMILES | N#Cc1ccncc1NCCC1CCCCO1 |
| InChI | InChI=1S/C13H17N3O/c14-9-11-4-6-15-10-13(11)16-7-5-12-3-1-2-8-17-12/h4,6,10,12,16H,1-3,5,7-8H2 |
| InChIKey | GQWFXYFWCXZLDH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |