C18H16BF2NO2 — CID 11336372
2-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]-5-fluorobenzonitrile (PubChem CID 11336372) has the molecular formula C18H16BF2NO2 and a molecular weight of 327.14 g/mol. Its IUPAC name is 2-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]-5-fluorobenzonitrile.
| Compound Name | 2-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 11336372 |
| Molecular Formula | C18H16BF2NO2 |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[5-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-2-fluorophenyl]-5-fluorobenzonitrile |
| SMILES | CC1(C)COB(c2ccc(F)c(-c3ccc(F)cc3C#N)c2)OC1 |
| InChI | InChI=1S/C18H16BF2NO2/c1-18(2)10-23-19(24-11-18)13-3-6-17(21)16(8-13)15-5-4-14(20)7-12(15)9-22/h3-8H,10-11H2,1-2H3 |
| InChIKey | DKKKPQOSPBCTLK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|