1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid

C8H12N2O2 — CID 1133641

IUPAC1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid
SMILESCCn1nc(C)c(C(=O)O)c1C
InChIInChI=1S/C8H12N2O2/c1-4-10-6(3)7(8(11)12)5(2)9-10/h4H2,1-3H3,(H,11,12)
InChIKeyUFMMFQJSODNLIG-UHFFFAOYSA-N
MW168.20 g/mol
LogP1.22
Rot. Bonds2

About 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid

1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid (PubChem CID 1133641) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid.

Molecular Properties

Compound Name1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid
PubChem CID1133641
Molecular FormulaC8H12N2O2
Molecular Weight168.20 g/mol
Exact Mass168.09
IUPAC Name1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid
SMILESCCn1nc(C)c(C(=O)O)c1C
InChIInChI=1S/C8H12N2O2/c1-4-10-6(3)7(8(11)12)5(2)9-10/h4H2,1-3H3,(H,11,12)
InChIKeyUFMMFQJSODNLIG-UHFFFAOYSA-N
XLogP1.22
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.20
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid?
The IUPAC name of 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid (CID 1133641) is 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid.
What is the SMILES notation for 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid?
The canonical SMILES for 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid is CCn1nc(C)c(C(=O)O)c1C.
What is the InChIKey of 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid?
The InChIKey is UFMMFQJSODNLIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-4-10-6(3)7(8(11)12)5(2)9-10/h4H2,1-3H3,(H,11,12).
What are the key properties of 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid?
1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid has a molecular weight of 168.20 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,5-dimethylpyrazole-4-carboxylic acid is sourced from PubChem (CID 1133641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).