About 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine
3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine (PubChem CID 113365122) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine |
| PubChem CID | 113365122 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine |
| SMILES | NC1CCC(NC2CC(N)c3ccccc32)CC1 |
| InChI | InChI=1S/C15H23N3/c16-10-5-7-11(8-6-10)18-15-9-14(17)12-3-1-2-4-13(12)15/h1-4,10-11,14-15,18H,5-9,16-17H2 |
| InChIKey | BIWBCXLRUHKBDH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine?
The IUPAC name of 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine (CID 113365122) is 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine.
What is the SMILES notation for 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine?
The canonical SMILES for 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine is NC1CCC(NC2CC(N)c3ccccc32)CC1.
What is the InChIKey of 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine?
The InChIKey is BIWBCXLRUHKBDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3/c16-10-5-7-11(8-6-10)18-15-9-14(17)12-3-1-2-4-13(12)15/h1-4,10-11,14-15,18H,5-9,16-17H2.
What are the key properties of 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine?
3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine has a molecular weight of 245.37 g/mol, XLogP of 1.99, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(4-aminocyclohexyl)-2,3-dihydro-1H-indene-1,3-diamine is sourced from PubChem (CID 113365122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).