About 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one
5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one (PubChem CID 113365132) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one |
| PubChem CID | 113365132 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one |
| SMILES | NC1CC(NCC2CCC(=O)N2)c2ccccc21 |
| InChI | InChI=1S/C14H19N3O/c15-12-7-13(11-4-2-1-3-10(11)12)16-8-9-5-6-14(18)17-9/h1-4,9,12-13,16H,5-8,15H2,(H,17,18) |
| InChIKey | BAJPNHYSKNOIRM-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one?
The IUPAC name of 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one (CID 113365132) is 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one?
The canonical SMILES for 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one is NC1CC(NCC2CCC(=O)N2)c2ccccc21.
What is the InChIKey of 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one?
The InChIKey is BAJPNHYSKNOIRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c15-12-7-13(11-4-2-1-3-10(11)12)16-8-9-5-6-14(18)17-9/h1-4,9,12-13,16H,5-8,15H2,(H,17,18).
What are the key properties of 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one?
5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one has a molecular weight of 245.33 g/mol, XLogP of 1.00, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(3-amino-2,3-dihydro-1H-inden-1-yl)amino]methyl]pyrrolidin-2-one is sourced from PubChem (CID 113365132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).