C16H17FN4O3 — CID 11336517
7-[(1R,5S)-6-amino-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclopropyl-6-fluoro-3-hydroxyquinazoline-2,4-dione (PubChem CID 11336517) has the molecular formula C16H17FN4O3 and a molecular weight of 332.34 g/mol. Its IUPAC name is 7-[(1R,5S)-6-amino-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclopropyl-6-fluoro-3-hydroxyquinazoline-2,4-dione.
| Compound Name | 7-[(1R,5S)-6-amino-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclopropyl-6-fluoro-3-hydroxyquinazoline-2,4-dione |
|---|---|
| PubChem CID | 11336517 |
| Molecular Formula | C16H17FN4O3 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 7-[(1R,5S)-6-amino-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclopropyl-6-fluoro-3-hydroxyquinazoline-2,4-dione |
| SMILES | NC1[C@H]2CN(c3cc4c(cc3F)c(=O)n(O)c(=O)n4C3CC3)C[C@@H]12 |
| InChI | InChI=1S/C16H17FN4O3/c17-11-3-8-12(4-13(11)19-5-9-10(6-19)14(9)18)20(7-1-2-7)16(23)21(24)15(8)22/h3-4,7,9-10,14,24H,1-2,5-6,18H2/t9-,10+,14? |
| InChIKey | ZLWMKUBMXWEZGO-XFLKPENQSA-N |
| XLogP | 0.27 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|