C13H16N2O2 — CID 113365416
3-[[1-(5-methyl-1,3-oxazol-2-yl)ethylamino]methyl]phenol (PubChem CID 113365416) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3-[[1-(5-methyl-1,3-oxazol-2-yl)ethylamino]methyl]phenol.
| Compound Name | 3-[[1-(5-methyl-1,3-oxazol-2-yl)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 113365416 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-[[1-(5-methyl-1,3-oxazol-2-yl)ethylamino]methyl]phenol |
| SMILES | Cc1cnc(C(C)NCc2cccc(O)c2)o1 |
| InChI | InChI=1S/C13H16N2O2/c1-9-7-15-13(17-9)10(2)14-8-11-4-3-5-12(16)6-11/h3-7,10,14,16H,8H2,1-2H3 |
| InChIKey | LXAQRRIMESFHGR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |