C14H19N3O — CID 113365536
(3,5-dimethyl-2-pyridinyl)-(1-propylimidazol-2-yl)methanol (PubChem CID 113365536) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is (3,5-dimethyl-2-pyridinyl)-(1-propylimidazol-2-yl)methanol.
| Compound Name | (3,5-dimethyl-2-pyridinyl)-(1-propylimidazol-2-yl)methanol |
|---|---|
| PubChem CID | 113365536 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (3,5-dimethyl-2-pyridinyl)-(1-propylimidazol-2-yl)methanol |
| SMILES | CCCn1ccnc1C(O)c1ncc(C)cc1C |
| InChI | InChI=1S/C14H19N3O/c1-4-6-17-7-5-15-14(17)13(18)12-11(3)8-10(2)9-16-12/h5,7-9,13,18H,4,6H2,1-3H3 |
| InChIKey | WJVKPEHSZHAILA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |