C7H5ClF5N3O2S — CID 113366092
4-cyclopropyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 113366092) has the molecular formula C7H5ClF5N3O2S and a molecular weight of 325.65 g/mol. Its IUPAC name is 4-cyclopropyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 4-cyclopropyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 113366092 |
| Molecular Formula | C7H5ClF5N3O2S |
| Molecular Weight | 325.65 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | 4-cyclopropyl-5-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1nnc(C(F)(F)C(F)(F)F)n1C1CC1 |
| InChI | InChI=1S/C7H5ClF5N3O2S/c8-19(17,18)5-15-14-4(16(5)3-1-2-3)6(9,10)7(11,12)13/h3H,1-2H2 |
| InChIKey | QDKYYQJWGWRWMH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.65 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|