About 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide
5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide (PubChem CID 113366401) has the molecular formula C10H10N6O2S
and a molecular weight of 278.30 g/mol. Its IUPAC name is 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide.
Molecular Properties
| Compound Name | 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide |
| PubChem CID | 113366401 |
| Molecular Formula | C10H10N6O2S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide |
| SMILES | CCn1c(-c2ccc(C#N)cn2)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C10H10N6O2S/c1-2-16-9(14-15-10(16)19(12,17)18)8-4-3-7(5-11)6-13-8/h3-4,6H,2H2,1H3,(H2,12,17,18) |
| InChIKey | AQIAQERXYGXYAU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 127.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide?
The IUPAC name of 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide (CID 113366401) is 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide.
What is the SMILES notation for 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide?
The canonical SMILES for 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide is CCn1c(-c2ccc(C#N)cn2)nnc1S(N)(=O)=O.
What is the InChIKey of 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide?
The InChIKey is AQIAQERXYGXYAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N6O2S/c1-2-16-9(14-15-10(16)19(12,17)18)8-4-3-7(5-11)6-13-8/h3-4,6H,2H2,1H3,(H2,12,17,18).
What are the key properties of 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide?
5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide has a molecular weight of 278.30 g/mol, XLogP of -0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-cyano-2-pyridinyl)-4-ethyl-1,2,4-triazole-3-sulfonamide is sourced from PubChem (CID 113366401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).