C8H3F5N4O2S — CID 113366465
3-(2,3,4,5,6-pentafluorophenyl)-1H-1,2,4-triazole-5-sulfonamide (PubChem CID 113366465) has the molecular formula C8H3F5N4O2S and a molecular weight of 314.20 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenyl)-1H-1,2,4-triazole-5-sulfonamide.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenyl)-1H-1,2,4-triazole-5-sulfonamide |
|---|---|
| PubChem CID | 113366465 |
| Molecular Formula | C8H3F5N4O2S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenyl)-1H-1,2,4-triazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1nc(-c2c(F)c(F)c(F)c(F)c2F)n[nH]1 |
| InChI | InChI=1S/C8H3F5N4O2S/c9-2-1(3(10)5(12)6(13)4(2)11)7-15-8(17-16-7)20(14,18)19/h(H2,14,18,19)(H,15,16,17) |
| InChIKey | HMWVXDZCTRYVKX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|