About 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide
5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide (PubChem CID 113366514) has the molecular formula C12H15FN4O2S
and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide.
Molecular Properties
| Compound Name | 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide |
| PubChem CID | 113366514 |
| Molecular Formula | C12H15FN4O2S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide |
| SMILES | CC(C)Cn1c(-c2ccccc2F)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C12H15FN4O2S/c1-8(2)7-17-11(9-5-3-4-6-10(9)13)15-16-12(17)20(14,18)19/h3-6,8H,7H2,1-2H3,(H2,14,18,19) |
| InChIKey | HXLNQUWJHHYLMQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide?
The IUPAC name of 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide (CID 113366514) is 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide.
What is the SMILES notation for 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide?
The canonical SMILES for 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide is CC(C)Cn1c(-c2ccccc2F)nnc1S(N)(=O)=O.
What is the InChIKey of 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide?
The InChIKey is HXLNQUWJHHYLMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FN4O2S/c1-8(2)7-17-11(9-5-3-4-6-10(9)13)15-16-12(17)20(14,18)19/h3-6,8H,7H2,1-2H3,(H2,14,18,19).
What are the key properties of 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide?
5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide has a molecular weight of 298.34 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluorophenyl)-4-(2-methylpropyl)-1,2,4-triazole-3-sulfonamide is sourced from PubChem (CID 113366514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).